C16H17Cl2F3N6OS — CID 178114653
6-[(2R)-2-amino-4-(trifluoromethoxy)butyl]-2,7-dichloro-5-methyl-N-(1,2-thiazol-3-ylmethyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 178114653) has the molecular formula C16H17Cl2F3N6OS and a molecular weight of 469.32 g/mol. Its IUPAC name is 6-[(2R)-2-amino-4-(trifluoromethoxy)butyl]-2,7-dichloro-5-methyl-N-(1,2-thiazol-3-ylmethyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 6-[(2R)-2-amino-4-(trifluoromethoxy)butyl]-2,7-dichloro-5-methyl-N-(1,2-thiazol-3-ylmethyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 178114653 |
| Molecular Formula | C16H17Cl2F3N6OS |
| Molecular Weight | 469.32 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | 6-[(2R)-2-amino-4-(trifluoromethoxy)butyl]-2,7-dichloro-5-methyl-N-(1,2-thiazol-3-ylmethyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | Cc1c(C[C@@H](N)CCOC(F)(F)F)c(Cl)n2nc(Cl)nc(NCc3ccsn3)c12 |
| InChI | InChI=1S/C16H17Cl2F3N6OS/c1-8-11(6-9(22)2-4-28-16(19,20)21)13(17)27-12(8)14(24-15(18)25-27)23-7-10-3-5-29-26-10/h3,5,9H,2,4,6-7,22H2,1H3,(H,23,24,25)/t9-/m0/s1 |
| InChIKey | JDBFQBGURBMBJH-VIFPVBQESA-N |
| XLogP | 4.21 |
| TPSA | 90.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.32 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |