C23H24FN5O4 — CID 178115052
[(Z)-[amino-[6-[(E)-3-imino-1-[3-methyl-4-[(2R)-2-methylazetidine-1-carbonyl]-1H-pyrrol-2-yl]prop-1-enoxy]-2-methyl-1-benzofuran-3-yl]methylidene]amino] hypofluorite (PubChem CID 178115052) has the molecular formula C23H24FN5O4 and a molecular weight of 453.47 g/mol. Its IUPAC name is [(Z)-[amino-[6-[(E)-3-imino-1-[3-methyl-4-[(2R)-2-methylazetidine-1-carbonyl]-1H-pyrrol-2-yl]prop-1-enoxy]-2-methyl-1-benzofuran-3-yl]methylidene]amino] hypofluorite.
| Compound Name | [(Z)-[amino-[6-[(E)-3-imino-1-[3-methyl-4-[(2R)-2-methylazetidine-1-carbonyl]-1H-pyrrol-2-yl]prop-1-enoxy]-2-methyl-1-benzofuran-3-yl]methylidene]amino] hypofluorite |
|---|---|
| PubChem CID | 178115052 |
| Molecular Formula | C23H24FN5O4 |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | [(Z)-[amino-[6-[(E)-3-imino-1-[3-methyl-4-[(2R)-2-methylazetidine-1-carbonyl]-1H-pyrrol-2-yl]prop-1-enoxy]-2-methyl-1-benzofuran-3-yl]methylidene]amino] hypofluorite |
| SMILES | [H]/N=C/C=C(/Oc1ccc2c(/C(N)=N/OF)c(C)oc2c1)c1[nH]cc(C(=O)N2CC[C@H]2C)c1C |
| InChI | InChI=1S/C23H24FN5O4/c1-12-7-9-29(12)23(30)17-11-27-21(13(17)2)18(6-8-25)32-15-4-5-16-19(10-15)31-14(3)20(16)22(26)28-33-24/h4-6,8,10-12,25,27H,7,9H2,1-3H3,(H2,26,28)/b18-6+,25-8+/t12-/m1/s1 |
| InChIKey | UYFKIBZQBWZIMB-JEAWRBFESA-N |
| XLogP | 4.20 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|