C28H35N7O5 — CID 178115136
3-[[amino-[(Z)-2-aminoethenyl]amino]methyl]-1-methylpyrrolidin-3-ol;6-(6-formyl-5-methylpyrrolo[1,2-b]pyridazin-4-yl)oxy-N,2-dimethyl-1-benzofuran-3-carboxamide (PubChem CID 178115136) has the molecular formula C28H35N7O5 and a molecular weight of 549.63 g/mol. Its IUPAC name is 3-[[amino-[(Z)-2-aminoethenyl]amino]methyl]-1-methylpyrrolidin-3-ol;6-(6-formyl-5-methylpyrrolo[1,2-b]pyridazin-4-yl)oxy-N,2-dimethyl-1-benzofuran-3-carboxamide.
| Compound Name | 3-[[amino-[(Z)-2-aminoethenyl]amino]methyl]-1-methylpyrrolidin-3-ol;6-(6-formyl-5-methylpyrrolo[1,2-b]pyridazin-4-yl)oxy-N,2-dimethyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 178115136 |
| Molecular Formula | C28H35N7O5 |
| Molecular Weight | 549.63 g/mol |
| Exact Mass | 549.27 |
| IUPAC Name | 3-[[amino-[(Z)-2-aminoethenyl]amino]methyl]-1-methylpyrrolidin-3-ol;6-(6-formyl-5-methylpyrrolo[1,2-b]pyridazin-4-yl)oxy-N,2-dimethyl-1-benzofuran-3-carboxamide |
| SMILES | CN1CCC(O)(CN(N)/C=C\N)C1.CNC(=O)c1c(C)oc2cc(Oc3ccnn4cc(C=O)c(C)c34)ccc12 |
| InChI | InChI=1S/C20H17N3O4.C8H18N4O/c1-11-13(10-24)9-23-19(11)16(6-7-22-23)27-14-4-5-15-17(8-14)26-12(2)18(15)20(25)21-3;1-11-4-2-8(13,6-11)7-12(10)5-3-9/h4-10H,1-3H3,(H,21,25);3,5,13H,2,4,6-7,9-10H2,1H3/b;5-3- |
| InChIKey | ZATLBFYSWOXIFE-PJAIOPLOSA-N |
| XLogP | 2.32 |
| TPSA | 164.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.63 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|