C24H26N4O4 — CID 178115241
6-[(E)-1-[4-[(2S,3R)-2,3-dimethylazetidine-1-carbonyl]-3-methyl-1H-pyrrol-2-yl]-3-iminoprop-1-enoxy]-2-methyl-1-benzofuran-3-carboxamide (PubChem CID 178115241) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is 6-[(E)-1-[4-[(2S,3R)-2,3-dimethylazetidine-1-carbonyl]-3-methyl-1H-pyrrol-2-yl]-3-iminoprop-1-enoxy]-2-methyl-1-benzofuran-3-carboxamide.
| Compound Name | 6-[(E)-1-[4-[(2S,3R)-2,3-dimethylazetidine-1-carbonyl]-3-methyl-1H-pyrrol-2-yl]-3-iminoprop-1-enoxy]-2-methyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 178115241 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 6-[(E)-1-[4-[(2S,3R)-2,3-dimethylazetidine-1-carbonyl]-3-methyl-1H-pyrrol-2-yl]-3-iminoprop-1-enoxy]-2-methyl-1-benzofuran-3-carboxamide |
| SMILES | [H]/N=C/C=C(/Oc1ccc2c(C(N)=O)c(C)oc2c1)c1[nH]cc(C(=O)N2C[C@@H](C)[C@@H]2C)c1C |
| InChI | InChI=1S/C24H26N4O4/c1-12-11-28(14(12)3)24(30)18-10-27-22(13(18)2)19(7-8-25)32-16-5-6-17-20(9-16)31-15(4)21(17)23(26)29/h5-10,12,14,25,27H,11H2,1-4H3,(H2,26,29)/b19-7+,25-8+/t12-,14+/m1/s1 |
| InChIKey | GCBQUBGUZNRATG-GRLFVTNOSA-N |
| XLogP | 4.03 |
| TPSA | 125.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|