C8H18N2S — CID 178115894
N,N-dimethyl-2-(3-methyl-1-sulfanylazetidin-3-yl)ethanamine (PubChem CID 178115894) has the molecular formula C8H18N2S and a molecular weight of 174.31 g/mol. Its IUPAC name is N,N-dimethyl-2-(3-methyl-1-sulfanylazetidin-3-yl)ethanamine.
| Compound Name | N,N-dimethyl-2-(3-methyl-1-sulfanylazetidin-3-yl)ethanamine |
|---|---|
| PubChem CID | 178115894 |
| Molecular Formula | C8H18N2S |
| Molecular Weight | 174.31 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | N,N-dimethyl-2-(3-methyl-1-sulfanylazetidin-3-yl)ethanamine |
| SMILES | CN(C)CCC1(C)CN(S)C1 |
| InChI | InChI=1S/C8H18N2S/c1-8(4-5-9(2)3)6-10(11)7-8/h11H,4-7H2,1-3H3 |
| InChIKey | HDIXMYISMHOBCG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|