C27H29N3O3 — CID 178116143
(2Z)-5,6-bis(ethenyl)-3-formyl-N,10-dimethyl-11-oxa-7,14-diazatetracyclo[12.6.1.14,7.015,20]docosa-1(21),2,4(22),5,15,17,19-heptaene-2-carboxamide (PubChem CID 178116143) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is (2Z)-5,6-bis(ethenyl)-3-formyl-N,10-dimethyl-11-oxa-7,14-diazatetracyclo[12.6.1.14,7.015,20]docosa-1(21),2,4(22),5,15,17,19-heptaene-2-carboxamide.
| Compound Name | (2Z)-5,6-bis(ethenyl)-3-formyl-N,10-dimethyl-11-oxa-7,14-diazatetracyclo[12.6.1.14,7.015,20]docosa-1(21),2,4(22),5,15,17,19-heptaene-2-carboxamide |
|---|---|
| PubChem CID | 178116143 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | (2Z)-5,6-bis(ethenyl)-3-formyl-N,10-dimethyl-11-oxa-7,14-diazatetracyclo[12.6.1.14,7.015,20]docosa-1(21),2,4(22),5,15,17,19-heptaene-2-carboxamide |
| SMILES | C=Cc1c2cn(c1C=C)CCC(C)OCCn1cc(c3ccccc31)/C(C(=O)NC)=C\2C=O |
| InChI | InChI=1S/C27H29N3O3/c1-5-19-21-15-29(24(19)6-2)12-11-18(3)33-14-13-30-16-22(20-9-7-8-10-25(20)30)26(23(21)17-31)27(32)28-4/h5-10,15-18H,1-2,11-14H2,3-4H3,(H,28,32)/b26-23+ |
| InChIKey | OKRBPSSEENHWFY-WNAAXNPUSA-N |
| XLogP | 4.39 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|