About 2-(3-methylcyclobutyl)-1,3,4-thiadiazole;2-phenyl-4-(trifluoromethyl)-3H-isoindol-1-one
2-(3-methylcyclobutyl)-1,3,4-thiadiazole;2-phenyl-4-(trifluoromethyl)-3H-isoindol-1-one (PubChem CID 178118734) has the molecular formula C22H20F3N3OS
and a molecular weight of 431.48 g/mol. Its IUPAC name is 2-(3-methylcyclobutyl)-1,3,4-thiadiazole;2-phenyl-4-(trifluoromethyl)-3H-isoindol-1-one.
Molecular Properties
| Compound Name | 2-(3-methylcyclobutyl)-1,3,4-thiadiazole;2-phenyl-4-(trifluoromethyl)-3H-isoindol-1-one |
| PubChem CID | 178118734 |
| Molecular Formula | C22H20F3N3OS |
| Molecular Weight | 431.48 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 2-(3-methylcyclobutyl)-1,3,4-thiadiazole;2-phenyl-4-(trifluoromethyl)-3H-isoindol-1-one |
| SMILES | CC1CC(c2nncs2)C1.O=C1c2cccc(C(F)(F)F)c2CN1c1ccccc1 |
| InChI | InChI=1S/C15H10F3NO.C7H10N2S/c16-15(17,18)13-8-4-7-11-12(13)9-19(14(11)20)10-5-2-1-3-6-10;1-5-2-6(3-5)7-9-8-4-10-7/h1-8H,9H2;4-6H,2-3H2,1H3 |
| InChIKey | CSQLSKGMNCCKCO-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.48 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-methylcyclobutyl)-1,3,4-thiadiazole;2-phenyl-4-(trifluoromethyl)-3H-isoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methylcyclobutyl)-1,3,4-thiadiazole;2-phenyl-4-(trifluoromethyl)-3H-isoindol-1-one?
The IUPAC name of 2-(3-methylcyclobutyl)-1,3,4-thiadiazole;2-phenyl-4-(trifluoromethyl)-3H-isoindol-1-one (CID 178118734) is 2-(3-methylcyclobutyl)-1,3,4-thiadiazole;2-phenyl-4-(trifluoromethyl)-3H-isoindol-1-one.
What is the SMILES notation for 2-(3-methylcyclobutyl)-1,3,4-thiadiazole;2-phenyl-4-(trifluoromethyl)-3H-isoindol-1-one?
The canonical SMILES for 2-(3-methylcyclobutyl)-1,3,4-thiadiazole;2-phenyl-4-(trifluoromethyl)-3H-isoindol-1-one is CC1CC(c2nncs2)C1.O=C1c2cccc(C(F)(F)F)c2CN1c1ccccc1.
What is the InChIKey of 2-(3-methylcyclobutyl)-1,3,4-thiadiazole;2-phenyl-4-(trifluoromethyl)-3H-isoindol-1-one?
The InChIKey is CSQLSKGMNCCKCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10F3NO.C7H10N2S/c16-15(17,18)13-8-4-7-11-12(13)9-19(14(11)20)10-5-2-1-3-6-10;1-5-2-6(3-5)7-9-8-4-10-7/h1-8H,9H2;4-6H,2-3H2,1H3.
What are the key properties of 2-(3-methylcyclobutyl)-1,3,4-thiadiazole;2-phenyl-4-(trifluoromethyl)-3H-isoindol-1-one?
2-(3-methylcyclobutyl)-1,3,4-thiadiazole;2-phenyl-4-(trifluoromethyl)-3H-isoindol-1-one has a molecular weight of 431.48 g/mol, XLogP of 5.92, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methylcyclobutyl)-1,3,4-thiadiazole;2-phenyl-4-(trifluoromethyl)-3H-isoindol-1-one is sourced from PubChem (CID 178118734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).