2-cyclobutyl-2-(5-nitrocyclohexa-1,5-dien-1-yl)acetic acid

C12H15NO4 — CID 178118817

IUPAC2-cyclobutyl-2-(5-nitrocyclohexa-1,5-dien-1-yl)acetic acid
SMILESO=C(O)C(C1=CCCC([N+](=O)[O-])=C1)C1CCC1
InChIInChI=1S/C12H15NO4/c14-12(15)11(8-3-1-4-8)9-5-2-6-10(7-9)13(16)17/h5,7-8,11H,1-4,6H2,(H,14,15)
InChIKeyAXMWHXSPSWLPGB-UHFFFAOYSA-N
MW237.25 g/mol
LogP2.37
Rot. Bonds4

About 2-cyclobutyl-2-(5-nitrocyclohexa-1,5-dien-1-yl)acetic acid

2-cyclobutyl-2-(5-nitrocyclohexa-1,5-dien-1-yl)acetic acid (PubChem CID 178118817) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is 2-cyclobutyl-2-(5-nitrocyclohexa-1,5-dien-1-yl)acetic acid.

Molecular Properties

Compound Name2-cyclobutyl-2-(5-nitrocyclohexa-1,5-dien-1-yl)acetic acid
PubChem CID178118817
Molecular FormulaC12H15NO4
Molecular Weight237.25 g/mol
Exact Mass237.10
IUPAC Name2-cyclobutyl-2-(5-nitrocyclohexa-1,5-dien-1-yl)acetic acid
SMILESO=C(O)C(C1=CCCC([N+](=O)[O-])=C1)C1CCC1
InChIInChI=1S/C12H15NO4/c14-12(15)11(8-3-1-4-8)9-5-2-6-10(7-9)13(16)17/h5,7-8,11H,1-4,6H2,(H,14,15)
InChIKeyAXMWHXSPSWLPGB-UHFFFAOYSA-N
XLogP2.37
TPSA80.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.25
LogP ≤ 52.37
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-cyclobutyl-2-(5-nitrocyclohexa-1,5-dien-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-cyclobutyl-2-(5-nitrocyclohexa-1,5-dien-1-yl)acetic acid?
The IUPAC name of 2-cyclobutyl-2-(5-nitrocyclohexa-1,5-dien-1-yl)acetic acid (CID 178118817) is 2-cyclobutyl-2-(5-nitrocyclohexa-1,5-dien-1-yl)acetic acid.
What is the SMILES notation for 2-cyclobutyl-2-(5-nitrocyclohexa-1,5-dien-1-yl)acetic acid?
The canonical SMILES for 2-cyclobutyl-2-(5-nitrocyclohexa-1,5-dien-1-yl)acetic acid is O=C(O)C(C1=CCCC([N+](=O)[O-])=C1)C1CCC1.
What is the InChIKey of 2-cyclobutyl-2-(5-nitrocyclohexa-1,5-dien-1-yl)acetic acid?
The InChIKey is AXMWHXSPSWLPGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO4/c14-12(15)11(8-3-1-4-8)9-5-2-6-10(7-9)13(16)17/h5,7-8,11H,1-4,6H2,(H,14,15).
What are the key properties of 2-cyclobutyl-2-(5-nitrocyclohexa-1,5-dien-1-yl)acetic acid?
2-cyclobutyl-2-(5-nitrocyclohexa-1,5-dien-1-yl)acetic acid has a molecular weight of 237.25 g/mol, XLogP of 2.37, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclobutyl-2-(5-nitrocyclohexa-1,5-dien-1-yl)acetic acid is sourced from PubChem (CID 178118817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).