About 2-cyclobutyl-2-(5-nitrocyclohexa-1,5-dien-1-yl)acetic acid
2-cyclobutyl-2-(5-nitrocyclohexa-1,5-dien-1-yl)acetic acid (PubChem CID 178118817) has the molecular formula C12H15NO4
and a molecular weight of 237.25 g/mol. Its IUPAC name is 2-cyclobutyl-2-(5-nitrocyclohexa-1,5-dien-1-yl)acetic acid.
Molecular Properties
| Compound Name | 2-cyclobutyl-2-(5-nitrocyclohexa-1,5-dien-1-yl)acetic acid |
| PubChem CID | 178118817 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2-cyclobutyl-2-(5-nitrocyclohexa-1,5-dien-1-yl)acetic acid |
| SMILES | O=C(O)C(C1=CCCC([N+](=O)[O-])=C1)C1CCC1 |
| InChI | InChI=1S/C12H15NO4/c14-12(15)11(8-3-1-4-8)9-5-2-6-10(7-9)13(16)17/h5,7-8,11H,1-4,6H2,(H,14,15) |
| InChIKey | AXMWHXSPSWLPGB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclobutyl-2-(5-nitrocyclohexa-1,5-dien-1-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclobutyl-2-(5-nitrocyclohexa-1,5-dien-1-yl)acetic acid?
The IUPAC name of 2-cyclobutyl-2-(5-nitrocyclohexa-1,5-dien-1-yl)acetic acid (CID 178118817) is 2-cyclobutyl-2-(5-nitrocyclohexa-1,5-dien-1-yl)acetic acid.
What is the SMILES notation for 2-cyclobutyl-2-(5-nitrocyclohexa-1,5-dien-1-yl)acetic acid?
The canonical SMILES for 2-cyclobutyl-2-(5-nitrocyclohexa-1,5-dien-1-yl)acetic acid is O=C(O)C(C1=CCCC([N+](=O)[O-])=C1)C1CCC1.
What is the InChIKey of 2-cyclobutyl-2-(5-nitrocyclohexa-1,5-dien-1-yl)acetic acid?
The InChIKey is AXMWHXSPSWLPGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO4/c14-12(15)11(8-3-1-4-8)9-5-2-6-10(7-9)13(16)17/h5,7-8,11H,1-4,6H2,(H,14,15).
What are the key properties of 2-cyclobutyl-2-(5-nitrocyclohexa-1,5-dien-1-yl)acetic acid?
2-cyclobutyl-2-(5-nitrocyclohexa-1,5-dien-1-yl)acetic acid has a molecular weight of 237.25 g/mol, XLogP of 2.37, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclobutyl-2-(5-nitrocyclohexa-1,5-dien-1-yl)acetic acid is sourced from PubChem (CID 178118817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).