C11H15F3N2O3 — CID 178118975
[(E)-1-oxo-1-(piperidin-4-ylamino)but-2-en-2-yl] 2,2,2-trifluoroacetate (PubChem CID 178118975) has the molecular formula C11H15F3N2O3 and a molecular weight of 280.25 g/mol. Its IUPAC name is [(E)-1-oxo-1-(piperidin-4-ylamino)but-2-en-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(E)-1-oxo-1-(piperidin-4-ylamino)but-2-en-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 178118975 |
| Molecular Formula | C11H15F3N2O3 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | [(E)-1-oxo-1-(piperidin-4-ylamino)but-2-en-2-yl] 2,2,2-trifluoroacetate |
| SMILES | C/C=C(/OC(=O)C(F)(F)F)C(=O)NC1CCNCC1 |
| InChI | InChI=1S/C11H15F3N2O3/c1-2-8(19-10(18)11(12,13)14)9(17)16-7-3-5-15-6-4-7/h2,7,15H,3-6H2,1H3,(H,16,17)/b8-2+ |
| InChIKey | PTSZUJZXAAYVDF-KRXBUXKQSA-N |
| XLogP | 0.86 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|