C31H32F3N5O3 — CID 178119149
N-[3-[[2-[3-[3-methyl-1-(4-methyl-1,2,4-triazol-3-yl)cyclobutyl]phenyl]-3-oxo-7-(trifluoromethyl)-1H-isoindol-5-yl]methoxy]propyl]but-2-ynamide (PubChem CID 178119149) has the molecular formula C31H32F3N5O3 and a molecular weight of 579.62 g/mol. Its IUPAC name is N-[3-[[2-[3-[3-methyl-1-(4-methyl-1,2,4-triazol-3-yl)cyclobutyl]phenyl]-3-oxo-7-(trifluoromethyl)-1H-isoindol-5-yl]methoxy]propyl]but-2-ynamide.
| Compound Name | N-[3-[[2-[3-[3-methyl-1-(4-methyl-1,2,4-triazol-3-yl)cyclobutyl]phenyl]-3-oxo-7-(trifluoromethyl)-1H-isoindol-5-yl]methoxy]propyl]but-2-ynamide |
|---|---|
| PubChem CID | 178119149 |
| Molecular Formula | C31H32F3N5O3 |
| Molecular Weight | 579.62 g/mol |
| Exact Mass | 579.25 |
| IUPAC Name | N-[3-[[2-[3-[3-methyl-1-(4-methyl-1,2,4-triazol-3-yl)cyclobutyl]phenyl]-3-oxo-7-(trifluoromethyl)-1H-isoindol-5-yl]methoxy]propyl]but-2-ynamide |
| SMILES | CC#CC(=O)NCCCOCc1cc2c(c(C(F)(F)F)c1)CN(c1cccc(C3(c4nncn4C)CC(C)C3)c1)C2=O |
| InChI | InChI=1S/C31H32F3N5O3/c1-4-7-27(40)35-10-6-11-42-18-21-12-24-25(26(13-21)31(32,33)34)17-39(28(24)41)23-9-5-8-22(14-23)30(15-20(2)16-30)29-37-36-19-38(29)3/h5,8-9,12-14,19-20H,6,10-11,15-18H2,1-3H3,(H,35,40) |
| InChIKey | YPUMKVBTZLPJDH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.62 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|