C34H41F3N6O3 — CID 178119455
tert-butyl N-[3-[[2-(3-cyclobutylphenyl)-3-oxo-7-(trifluoromethyl)-1H-isoindol-5-yl]methyl-prop-2-ynylamino]propyl]carbamate;4-methyl-1,2,4-triazole (PubChem CID 178119455) has the molecular formula C34H41F3N6O3 and a molecular weight of 638.74 g/mol. Its IUPAC name is tert-butyl N-[3-[[2-(3-cyclobutylphenyl)-3-oxo-7-(trifluoromethyl)-1H-isoindol-5-yl]methyl-prop-2-ynylamino]propyl]carbamate;4-methyl-1,2,4-triazole.
| Compound Name | tert-butyl N-[3-[[2-(3-cyclobutylphenyl)-3-oxo-7-(trifluoromethyl)-1H-isoindol-5-yl]methyl-prop-2-ynylamino]propyl]carbamate;4-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 178119455 |
| Molecular Formula | C34H41F3N6O3 |
| Molecular Weight | 638.74 g/mol |
| Exact Mass | 638.32 |
| IUPAC Name | tert-butyl N-[3-[[2-(3-cyclobutylphenyl)-3-oxo-7-(trifluoromethyl)-1H-isoindol-5-yl]methyl-prop-2-ynylamino]propyl]carbamate;4-methyl-1,2,4-triazole |
| SMILES | C#CCN(CCCNC(=O)OC(C)(C)C)Cc1cc2c(c(C(F)(F)F)c1)CN(c1cccc(C3CCC3)c1)C2=O.Cn1cnnc1 |
| InChI | InChI=1S/C31H36F3N3O3.C3H5N3/c1-5-14-36(15-8-13-35-29(39)40-30(2,3)4)19-21-16-25-26(27(17-21)31(32,33)34)20-37(28(25)38)24-12-7-11-23(18-24)22-9-6-10-22;1-6-2-4-5-3-6/h1,7,11-12,16-18,22H,6,8-10,13-15,19-20H2,2-4H3,(H,35,39);2-3H,1H3 |
| InChIKey | MXKCWPMGTODKFY-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.74 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|