C23H25F3N2O — CID 178119525
6-[(5-methylhex-5-en-2-ylamino)methyl]-2-phenyl-4-(trifluoromethyl)-3H-isoindol-1-one (PubChem CID 178119525) has the molecular formula C23H25F3N2O and a molecular weight of 402.46 g/mol. Its IUPAC name is 6-[(5-methylhex-5-en-2-ylamino)methyl]-2-phenyl-4-(trifluoromethyl)-3H-isoindol-1-one.
| Compound Name | 6-[(5-methylhex-5-en-2-ylamino)methyl]-2-phenyl-4-(trifluoromethyl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 178119525 |
| Molecular Formula | C23H25F3N2O |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 6-[(5-methylhex-5-en-2-ylamino)methyl]-2-phenyl-4-(trifluoromethyl)-3H-isoindol-1-one |
| SMILES | C=C(C)CCC(C)NCc1cc2c(c(C(F)(F)F)c1)CN(c1ccccc1)C2=O |
| InChI | InChI=1S/C23H25F3N2O/c1-15(2)9-10-16(3)27-13-17-11-19-20(21(12-17)23(24,25)26)14-28(22(19)29)18-7-5-4-6-8-18/h4-8,11-12,16,27H,1,9-10,13-14H2,2-3H3 |
| InChIKey | CXVWFMKMIJEQOA-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|