About N-[(1,3-dimethylcyclobutyl)methyl]-N-methylmethanimidamide
N-[(1,3-dimethylcyclobutyl)methyl]-N-methylmethanimidamide (PubChem CID 178119748) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is N-[(1,3-dimethylcyclobutyl)methyl]-N-methylmethanimidamide.
Molecular Properties
| Compound Name | N-[(1,3-dimethylcyclobutyl)methyl]-N-methylmethanimidamide |
| PubChem CID | 178119748 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | N-[(1,3-dimethylcyclobutyl)methyl]-N-methylmethanimidamide |
| SMILES | [H]/N=C/N(C)CC1(C)CC(C)C1 |
| InChI | InChI=1S/C9H18N2/c1-8-4-9(2,5-8)6-11(3)7-10/h7-8,10H,4-6H2,1-3H3/b10-7+ |
| InChIKey | OWDISMIQGMLACN-JXMROGBWSA-N |
| XLogP | 1.96 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(1,3-dimethylcyclobutyl)methyl]-N-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,3-dimethylcyclobutyl)methyl]-N-methylmethanimidamide?
The IUPAC name of N-[(1,3-dimethylcyclobutyl)methyl]-N-methylmethanimidamide (CID 178119748) is N-[(1,3-dimethylcyclobutyl)methyl]-N-methylmethanimidamide.
What is the SMILES notation for N-[(1,3-dimethylcyclobutyl)methyl]-N-methylmethanimidamide?
The canonical SMILES for N-[(1,3-dimethylcyclobutyl)methyl]-N-methylmethanimidamide is [H]/N=C/N(C)CC1(C)CC(C)C1.
What is the InChIKey of N-[(1,3-dimethylcyclobutyl)methyl]-N-methylmethanimidamide?
The InChIKey is OWDISMIQGMLACN-JXMROGBWSA-N. The full InChI is InChI=1S/C9H18N2/c1-8-4-9(2,5-8)6-11(3)7-10/h7-8,10H,4-6H2,1-3H3/b10-7+.
What are the key properties of N-[(1,3-dimethylcyclobutyl)methyl]-N-methylmethanimidamide?
N-[(1,3-dimethylcyclobutyl)methyl]-N-methylmethanimidamide has a molecular weight of 154.26 g/mol, XLogP of 1.96, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,3-dimethylcyclobutyl)methyl]-N-methylmethanimidamide is sourced from PubChem (CID 178119748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).