C32H35F3N6O2 — CID 178119880
N-[3-[[2-(3-cyclobutylphenyl)-3-oxo-7-(trifluoromethyl)-1H-isoindol-5-yl]methylamino]propyl]-N-prop-2-ynylprop-2-enamide;4-methyl-1,2,4-triazole (PubChem CID 178119880) has the molecular formula C32H35F3N6O2 and a molecular weight of 592.67 g/mol. Its IUPAC name is N-[3-[[2-(3-cyclobutylphenyl)-3-oxo-7-(trifluoromethyl)-1H-isoindol-5-yl]methylamino]propyl]-N-prop-2-ynylprop-2-enamide;4-methyl-1,2,4-triazole.
| Compound Name | N-[3-[[2-(3-cyclobutylphenyl)-3-oxo-7-(trifluoromethyl)-1H-isoindol-5-yl]methylamino]propyl]-N-prop-2-ynylprop-2-enamide;4-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 178119880 |
| Molecular Formula | C32H35F3N6O2 |
| Molecular Weight | 592.67 g/mol |
| Exact Mass | 592.28 |
| IUPAC Name | N-[3-[[2-(3-cyclobutylphenyl)-3-oxo-7-(trifluoromethyl)-1H-isoindol-5-yl]methylamino]propyl]-N-prop-2-ynylprop-2-enamide;4-methyl-1,2,4-triazole |
| SMILES | C#CCN(CCCNCc1cc2c(c(C(F)(F)F)c1)CN(c1cccc(C3CCC3)c1)C2=O)C(=O)C=C.Cn1cnnc1 |
| InChI | InChI=1S/C29H30F3N3O2.C3H5N3/c1-3-13-34(27(36)4-2)14-7-12-33-18-20-15-24-25(26(16-20)29(30,31)32)19-35(28(24)37)23-11-6-10-22(17-23)21-8-5-9-21;1-6-2-4-5-3-6/h1,4,6,10-11,15-17,21,33H,2,5,7-9,12-14,18-19H2;2-3H,1H3 |
| InChIKey | GEJSDTMYMJWBTE-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.67 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|