C16F18 — CID 178120433
1,3,5-trifluoro-2-[2,4,6-trifluoro-3,5-bis(trifluoromethyl)phenyl]-4,6-bis(trifluoromethyl)benzene (PubChem CID 178120433) has the molecular formula C16F18 and a molecular weight of 534.14 g/mol. Its IUPAC name is 1,3,5-trifluoro-2-[2,4,6-trifluoro-3,5-bis(trifluoromethyl)phenyl]-4,6-bis(trifluoromethyl)benzene.
| Compound Name | 1,3,5-trifluoro-2-[2,4,6-trifluoro-3,5-bis(trifluoromethyl)phenyl]-4,6-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 178120433 |
| Molecular Formula | C16F18 |
| Molecular Weight | 534.14 g/mol |
| Exact Mass | 533.97 |
| IUPAC Name | 1,3,5-trifluoro-2-[2,4,6-trifluoro-3,5-bis(trifluoromethyl)phenyl]-4,6-bis(trifluoromethyl)benzene |
| SMILES | Fc1c(-c2c(F)c(C(F)(F)F)c(F)c(C(F)(F)F)c2F)c(F)c(C(F)(F)F)c(F)c1C(F)(F)F |
| InChI | InChI=1S/C16F18/c17-7-1(8(18)4(14(26,27)28)11(21)3(7)13(23,24)25)2-9(19)5(15(29,30)31)12(22)6(10(2)20)16(32,33)34 |
| InChIKey | XSDWXYCRZNZUFC-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.14 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |