C17H11ClFN5 — CID 178120625
2-chloro-4-(8-fluoroquinolin-7-yl)-6,7-dimethylpteridine (PubChem CID 178120625) has the molecular formula C17H11ClFN5 and a molecular weight of 339.76 g/mol. Its IUPAC name is 2-chloro-4-(8-fluoroquinolin-7-yl)-6,7-dimethylpteridine.
| Compound Name | 2-chloro-4-(8-fluoroquinolin-7-yl)-6,7-dimethylpteridine |
|---|---|
| PubChem CID | 178120625 |
| Molecular Formula | C17H11ClFN5 |
| Molecular Weight | 339.76 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 2-chloro-4-(8-fluoroquinolin-7-yl)-6,7-dimethylpteridine |
| SMILES | Cc1nc2nc(Cl)nc(-c3ccc4cccnc4c3F)c2nc1C |
| InChI | InChI=1S/C17H11ClFN5/c1-8-9(2)22-16-15(21-8)14(23-17(18)24-16)11-6-5-10-4-3-7-20-13(10)12(11)19/h3-7H,1-2H3 |
| InChIKey | BPBUFAVPALJOBP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.76 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |