C14H13N5O — CID 178122092
N-[5-ethynyl-8-(methylamino)pyrido[3,4-c]pyridazin-3-yl]cyclopropanecarboxamide (PubChem CID 178122092) has the molecular formula C14H13N5O and a molecular weight of 267.29 g/mol. Its IUPAC name is N-[5-ethynyl-8-(methylamino)pyrido[3,4-c]pyridazin-3-yl]cyclopropanecarboxamide.
| Compound Name | N-[5-ethynyl-8-(methylamino)pyrido[3,4-c]pyridazin-3-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 178122092 |
| Molecular Formula | C14H13N5O |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | N-[5-ethynyl-8-(methylamino)pyrido[3,4-c]pyridazin-3-yl]cyclopropanecarboxamide |
| SMILES | C#Cc1cnc(NC)c2nnc(NC(=O)C3CC3)cc12 |
| InChI | InChI=1S/C14H13N5O/c1-3-8-7-16-13(15-2)12-10(8)6-11(18-19-12)17-14(20)9-4-5-9/h1,6-7,9H,4-5H2,2H3,(H,15,16)(H,17,18,20) |
| InChIKey | KNDUKZCEPSHQMJ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|