C19H20N6O — CID 178122652
1-N-methyl-4-[2-[1-(oxan-2-yl)pyrazol-4-yl]ethynyl]-2,7-naphthyridine-1,6-diamine (PubChem CID 178122652) has the molecular formula C19H20N6O and a molecular weight of 348.41 g/mol. Its IUPAC name is 1-N-methyl-4-[2-[1-(oxan-2-yl)pyrazol-4-yl]ethynyl]-2,7-naphthyridine-1,6-diamine.
| Compound Name | 1-N-methyl-4-[2-[1-(oxan-2-yl)pyrazol-4-yl]ethynyl]-2,7-naphthyridine-1,6-diamine |
|---|---|
| PubChem CID | 178122652 |
| Molecular Formula | C19H20N6O |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 1-N-methyl-4-[2-[1-(oxan-2-yl)pyrazol-4-yl]ethynyl]-2,7-naphthyridine-1,6-diamine |
| SMILES | CNc1ncc(C#Cc2cnn(C3CCCCO3)c2)c2cc(N)ncc12 |
| InChI | InChI=1S/C19H20N6O/c1-21-19-16-11-22-17(20)8-15(16)14(10-23-19)6-5-13-9-24-25(12-13)18-4-2-3-7-26-18/h8-12,18H,2-4,7H2,1H3,(H2,20,22)(H,21,23) |
| InChIKey | DGKFOJSDYLBLKG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|