C15H21NOSi — CID 178122866
trimethyl-[2-[5-[[(3S)-oxolan-3-yl]methyl]-2-pyridinyl]ethynyl]silane (PubChem CID 178122866) has the molecular formula C15H21NOSi and a molecular weight of 259.43 g/mol. Its IUPAC name is trimethyl-[2-[5-[[(3S)-oxolan-3-yl]methyl]-2-pyridinyl]ethynyl]silane.
| Compound Name | trimethyl-[2-[5-[[(3S)-oxolan-3-yl]methyl]-2-pyridinyl]ethynyl]silane |
|---|---|
| PubChem CID | 178122866 |
| Molecular Formula | C15H21NOSi |
| Molecular Weight | 259.43 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | trimethyl-[2-[5-[[(3S)-oxolan-3-yl]methyl]-2-pyridinyl]ethynyl]silane |
| SMILES | C[Si](C)(C)C#Cc1ccc(C[C@H]2CCOC2)cn1 |
| InChI | InChI=1S/C15H21NOSi/c1-18(2,3)9-7-15-5-4-13(11-16-15)10-14-6-8-17-12-14/h4-5,11,14H,6,8,10,12H2,1-3H3/t14-/m1/s1 |
| InChIKey | DVAQNJIRAMCJOJ-CQSZACIVSA-N |
| XLogP | 2.89 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|