C19H23F3N4O3S — CID 178123410
2-but-3-enyl-1-(1H-imidazol-5-ylmethyl)-7-methoxy-4-(trifluoromethylsulfonyl)-3,5-dihydro-2H-1,4-benzodiazepine (PubChem CID 178123410) has the molecular formula C19H23F3N4O3S and a molecular weight of 444.48 g/mol. Its IUPAC name is 2-but-3-enyl-1-(1H-imidazol-5-ylmethyl)-7-methoxy-4-(trifluoromethylsulfonyl)-3,5-dihydro-2H-1,4-benzodiazepine.
| Compound Name | 2-but-3-enyl-1-(1H-imidazol-5-ylmethyl)-7-methoxy-4-(trifluoromethylsulfonyl)-3,5-dihydro-2H-1,4-benzodiazepine |
|---|---|
| PubChem CID | 178123410 |
| Molecular Formula | C19H23F3N4O3S |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 2-but-3-enyl-1-(1H-imidazol-5-ylmethyl)-7-methoxy-4-(trifluoromethylsulfonyl)-3,5-dihydro-2H-1,4-benzodiazepine |
| SMILES | C=CCCC1CN(S(=O)(=O)C(F)(F)F)Cc2cc(OC)ccc2N1Cc1cnc[nH]1 |
| InChI | InChI=1S/C19H23F3N4O3S/c1-3-4-5-16-12-25(30(27,28)19(20,21)22)10-14-8-17(29-2)6-7-18(14)26(16)11-15-9-23-13-24-15/h3,6-9,13,16H,1,4-5,10-12H2,2H3,(H,23,24) |
| InChIKey | RRGDMPCQFOZFJI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|