C22H21F3N4O — CID 178124184
1-[2-cyclobuta-1,2-dien-1-yl-6-cyclopropyl-1-(1H-imidazol-5-ylmethyl)-3,5-dihydro-2H-1,4-benzodiazepin-4-yl]-2,2,2-trifluoroethanone (PubChem CID 178124184) has the molecular formula C22H21F3N4O and a molecular weight of 414.43 g/mol. Its IUPAC name is 1-[2-cyclobuta-1,2-dien-1-yl-6-cyclopropyl-1-(1H-imidazol-5-ylmethyl)-3,5-dihydro-2H-1,4-benzodiazepin-4-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[2-cyclobuta-1,2-dien-1-yl-6-cyclopropyl-1-(1H-imidazol-5-ylmethyl)-3,5-dihydro-2H-1,4-benzodiazepin-4-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 178124184 |
| Molecular Formula | C22H21F3N4O |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 1-[2-cyclobuta-1,2-dien-1-yl-6-cyclopropyl-1-(1H-imidazol-5-ylmethyl)-3,5-dihydro-2H-1,4-benzodiazepin-4-yl]-2,2,2-trifluoroethanone |
| SMILES | O=C(N1Cc2c(C3CC3)cccc2N(Cc2cnc[nH]2)C(C2=C=CC2)C1)C(F)(F)F |
| InChI | InChI=1S/C22H21F3N4O/c23-22(24,25)21(30)28-11-18-17(14-7-8-14)5-2-6-19(18)29(10-16-9-26-13-27-16)20(12-28)15-3-1-4-15/h1-2,5-6,9,13-14,20H,3,7-8,10-12H2,(H,26,27) |
| InChIKey | DNARERZEFHCLNZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |