About ethane;2-methyl-7-propan-2-yl-3-(trifluoromethylsulfanyl)pyrazolo[1,5-a]pyridine
ethane;2-methyl-7-propan-2-yl-3-(trifluoromethylsulfanyl)pyrazolo[1,5-a]pyridine (PubChem CID 178124797) has the molecular formula C14H19F3N2S
and a molecular weight of 304.38 g/mol. Its IUPAC name is ethane;2-methyl-7-propan-2-yl-3-(trifluoromethylsulfanyl)pyrazolo[1,5-a]pyridine.
Molecular Properties
| Compound Name | ethane;2-methyl-7-propan-2-yl-3-(trifluoromethylsulfanyl)pyrazolo[1,5-a]pyridine |
| PubChem CID | 178124797 |
| Molecular Formula | C14H19F3N2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | ethane;2-methyl-7-propan-2-yl-3-(trifluoromethylsulfanyl)pyrazolo[1,5-a]pyridine |
| SMILES | CC.Cc1nn2c(C(C)C)cccc2c1SC(F)(F)F |
| InChI | InChI=1S/C12H13F3N2S.C2H6/c1-7(2)9-5-4-6-10-11(18-12(13,14)15)8(3)16-17(9)10;1-2/h4-7H,1-3H3;1-2H3 |
| InChIKey | JWNNYADFVHQJBK-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2-methyl-7-propan-2-yl-3-(trifluoromethylsulfanyl)pyrazolo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyl-7-propan-2-yl-3-(trifluoromethylsulfanyl)pyrazolo[1,5-a]pyridine?
The IUPAC name of ethane;2-methyl-7-propan-2-yl-3-(trifluoromethylsulfanyl)pyrazolo[1,5-a]pyridine (CID 178124797) is ethane;2-methyl-7-propan-2-yl-3-(trifluoromethylsulfanyl)pyrazolo[1,5-a]pyridine.
What is the SMILES notation for ethane;2-methyl-7-propan-2-yl-3-(trifluoromethylsulfanyl)pyrazolo[1,5-a]pyridine?
The canonical SMILES for ethane;2-methyl-7-propan-2-yl-3-(trifluoromethylsulfanyl)pyrazolo[1,5-a]pyridine is CC.Cc1nn2c(C(C)C)cccc2c1SC(F)(F)F.
What is the InChIKey of ethane;2-methyl-7-propan-2-yl-3-(trifluoromethylsulfanyl)pyrazolo[1,5-a]pyridine?
The InChIKey is JWNNYADFVHQJBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F3N2S.C2H6/c1-7(2)9-5-4-6-10-11(18-12(13,14)15)8(3)16-17(9)10;1-2/h4-7H,1-3H3;1-2H3.
What are the key properties of ethane;2-methyl-7-propan-2-yl-3-(trifluoromethylsulfanyl)pyrazolo[1,5-a]pyridine?
ethane;2-methyl-7-propan-2-yl-3-(trifluoromethylsulfanyl)pyrazolo[1,5-a]pyridine has a molecular weight of 304.38 g/mol, XLogP of 5.40, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-7-propan-2-yl-3-(trifluoromethylsulfanyl)pyrazolo[1,5-a]pyridine is sourced from PubChem (CID 178124797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).