About 2,7-di(propan-2-yl)-3-(trifluoromethylsulfanyl)pyrazolo[1,5-a]pyridine
2,7-di(propan-2-yl)-3-(trifluoromethylsulfanyl)pyrazolo[1,5-a]pyridine (PubChem CID 178124886) has the molecular formula C14H17F3N2S
and a molecular weight of 302.37 g/mol. Its IUPAC name is 2,7-di(propan-2-yl)-3-(trifluoromethylsulfanyl)pyrazolo[1,5-a]pyridine.
Molecular Properties
| Compound Name | 2,7-di(propan-2-yl)-3-(trifluoromethylsulfanyl)pyrazolo[1,5-a]pyridine |
| PubChem CID | 178124886 |
| Molecular Formula | C14H17F3N2S |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2,7-di(propan-2-yl)-3-(trifluoromethylsulfanyl)pyrazolo[1,5-a]pyridine |
| SMILES | CC(C)c1nn2c(C(C)C)cccc2c1SC(F)(F)F |
| InChI | InChI=1S/C14H17F3N2S/c1-8(2)10-6-5-7-11-13(20-14(15,16)17)12(9(3)4)18-19(10)11/h5-9H,1-4H3 |
| InChIKey | CQFBHDYQOGTVLN-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,7-di(propan-2-yl)-3-(trifluoromethylsulfanyl)pyrazolo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-di(propan-2-yl)-3-(trifluoromethylsulfanyl)pyrazolo[1,5-a]pyridine?
The IUPAC name of 2,7-di(propan-2-yl)-3-(trifluoromethylsulfanyl)pyrazolo[1,5-a]pyridine (CID 178124886) is 2,7-di(propan-2-yl)-3-(trifluoromethylsulfanyl)pyrazolo[1,5-a]pyridine.
What is the SMILES notation for 2,7-di(propan-2-yl)-3-(trifluoromethylsulfanyl)pyrazolo[1,5-a]pyridine?
The canonical SMILES for 2,7-di(propan-2-yl)-3-(trifluoromethylsulfanyl)pyrazolo[1,5-a]pyridine is CC(C)c1nn2c(C(C)C)cccc2c1SC(F)(F)F.
What is the InChIKey of 2,7-di(propan-2-yl)-3-(trifluoromethylsulfanyl)pyrazolo[1,5-a]pyridine?
The InChIKey is CQFBHDYQOGTVLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17F3N2S/c1-8(2)10-6-5-7-11-13(20-14(15,16)17)12(9(3)4)18-19(10)11/h5-9H,1-4H3.
What are the key properties of 2,7-di(propan-2-yl)-3-(trifluoromethylsulfanyl)pyrazolo[1,5-a]pyridine?
2,7-di(propan-2-yl)-3-(trifluoromethylsulfanyl)pyrazolo[1,5-a]pyridine has a molecular weight of 302.37 g/mol, XLogP of 5.19, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-di(propan-2-yl)-3-(trifluoromethylsulfanyl)pyrazolo[1,5-a]pyridine is sourced from PubChem (CID 178124886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).