C9H17FN2O — CID 178125144
(3S,4R)-3-fluoro-1-(3-methyloxetan-3-yl)piperidin-4-amine (PubChem CID 178125144) has the molecular formula C9H17FN2O and a molecular weight of 188.25 g/mol. Its IUPAC name is (3S,4R)-3-fluoro-1-(3-methyloxetan-3-yl)piperidin-4-amine.
| Compound Name | (3S,4R)-3-fluoro-1-(3-methyloxetan-3-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 178125144 |
| Molecular Formula | C9H17FN2O |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | (3S,4R)-3-fluoro-1-(3-methyloxetan-3-yl)piperidin-4-amine |
| SMILES | CC1(N2CC[C@@H](N)[C@@H](F)C2)COC1 |
| InChI | InChI=1S/C9H17FN2O/c1-9(5-13-6-9)12-3-2-8(11)7(10)4-12/h7-8H,2-6,11H2,1H3/t7-,8+/m0/s1 |
| InChIKey | DNYSBSCAMINKHC-JGVFFNPUSA-N |
| XLogP | 0.15 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |