C10H14FN2O2S+ — CID 178125298
3-(3-fluoro-4-methyl-2,3,4,5-tetrahydropyridin-1-ium-1-yl)-1,1-dioxothietane-3-carbonitrile (PubChem CID 178125298) has the molecular formula C10H14FN2O2S+ and a molecular weight of 245.30 g/mol. Its IUPAC name is 3-(3-fluoro-4-methyl-2,3,4,5-tetrahydropyridin-1-ium-1-yl)-1,1-dioxothietane-3-carbonitrile.
| Compound Name | 3-(3-fluoro-4-methyl-2,3,4,5-tetrahydropyridin-1-ium-1-yl)-1,1-dioxothietane-3-carbonitrile |
|---|---|
| PubChem CID | 178125298 |
| Molecular Formula | C10H14FN2O2S+ |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 3-(3-fluoro-4-methyl-2,3,4,5-tetrahydropyridin-1-ium-1-yl)-1,1-dioxothietane-3-carbonitrile |
| SMILES | CC1CC=[N+](C2(C#N)CS(=O)(=O)C2)CC1F |
| InChI | InChI=1S/C10H14FN2O2S/c1-8-2-3-13(4-9(8)11)10(5-12)6-16(14,15)7-10/h3,8-9H,2,4,6-7H2,1H3/q+1 |
| InChIKey | HSCCLDRKTMACKZ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 60.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|