C16H12F3N5OSSe — CID 178125642
N-[3-[1-amino-6-(trifluoromethylselanyl)pyrrolo[1,2-a]pyrazin-7-yl]prop-2-ynyl]-2-methyl-1,3-thiazole-5-carboxamide (PubChem CID 178125642) has the molecular formula C16H12F3N5OSSe and a molecular weight of 458.33 g/mol. Its IUPAC name is N-[3-[1-amino-6-(trifluoromethylselanyl)pyrrolo[1,2-a]pyrazin-7-yl]prop-2-ynyl]-2-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[3-[1-amino-6-(trifluoromethylselanyl)pyrrolo[1,2-a]pyrazin-7-yl]prop-2-ynyl]-2-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 178125642 |
| Molecular Formula | C16H12F3N5OSSe |
| Molecular Weight | 458.33 g/mol |
| Exact Mass | 458.99 |
| IUPAC Name | N-[3-[1-amino-6-(trifluoromethylselanyl)pyrrolo[1,2-a]pyrazin-7-yl]prop-2-ynyl]-2-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ncc(C(=O)NCC#Cc2cc3c(N)nccn3c2[Se]C(F)(F)F)s1 |
| InChI | InChI=1S/C16H12F3N5OSSe/c1-9-23-8-12(26-9)14(25)22-4-2-3-10-7-11-13(20)21-5-6-24(11)15(10)27-16(17,18)19/h5-8H,4H2,1H3,(H2,20,21)(H,22,25) |
| InChIKey | KJFIIBPIVYNLOZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 85.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.33 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|