C35H46Si — CID 178126216
[5-(4-tert-butylphenyl)-2-methyl-6,7,8,9-tetrahydro-3H-cyclopenta[a]naphthalen-3-yl]-dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 178126216) has the molecular formula C35H46Si and a molecular weight of 494.84 g/mol. Its IUPAC name is [5-(4-tert-butylphenyl)-2-methyl-6,7,8,9-tetrahydro-3H-cyclopenta[a]naphthalen-3-yl]-dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | [5-(4-tert-butylphenyl)-2-methyl-6,7,8,9-tetrahydro-3H-cyclopenta[a]naphthalen-3-yl]-dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 178126216 |
| Molecular Formula | C35H46Si |
| Molecular Weight | 494.84 g/mol |
| Exact Mass | 494.34 |
| IUPAC Name | [5-(4-tert-butylphenyl)-2-methyl-6,7,8,9-tetrahydro-3H-cyclopenta[a]naphthalen-3-yl]-dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CC1=Cc2c(cc(-c3ccc(C(C)(C)C)cc3)c3c2CCCC3)C1[Si](C)(C)C1C(C)=C(C)C(C)=C1C |
| InChI | InChI=1S/C35H46Si/c1-21-19-31-29-14-12-11-13-28(29)30(26-15-17-27(18-16-26)35(6,7)8)20-32(31)33(21)36(9,10)34-24(4)22(2)23(3)25(34)5/h15-20,33-34H,11-14H2,1-10H3 |
| InChIKey | FYDVIDBUJXLPQN-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.84 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|