C16H16F4N4O2 — CID 178126561
1-(azetidin-1-yl)-2-[[6-(4-fluorophenyl)pyrimidin-4-yl]amino]ethanone;trifluoromethanol (PubChem CID 178126561) has the molecular formula C16H16F4N4O2 and a molecular weight of 372.32 g/mol. Its IUPAC name is 1-(azetidin-1-yl)-2-[[6-(4-fluorophenyl)pyrimidin-4-yl]amino]ethanone;trifluoromethanol.
| Compound Name | 1-(azetidin-1-yl)-2-[[6-(4-fluorophenyl)pyrimidin-4-yl]amino]ethanone;trifluoromethanol |
|---|---|
| PubChem CID | 178126561 |
| Molecular Formula | C16H16F4N4O2 |
| Molecular Weight | 372.32 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 1-(azetidin-1-yl)-2-[[6-(4-fluorophenyl)pyrimidin-4-yl]amino]ethanone;trifluoromethanol |
| SMILES | O=C(CNc1cc(-c2ccc(F)cc2)ncn1)N1CCC1.OC(F)(F)F |
| InChI | InChI=1S/C15H15FN4O.CHF3O/c16-12-4-2-11(3-5-12)13-8-14(19-10-18-13)17-9-15(21)20-6-1-7-20;2-1(3,4)5/h2-5,8,10H,1,6-7,9H2,(H,17,18,19);5H |
| InChIKey | LJRZAMJWHPVLRO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |