C5H8F3NO — CID 178126696
(2S,3S)-2-methyl-3-(trifluoromethoxy)azetidine (PubChem CID 178126696) has the molecular formula C5H8F3NO and a molecular weight of 155.12 g/mol. Its IUPAC name is (2S,3S)-2-methyl-3-(trifluoromethoxy)azetidine.
| Compound Name | (2S,3S)-2-methyl-3-(trifluoromethoxy)azetidine |
|---|---|
| PubChem CID | 178126696 |
| Molecular Formula | C5H8F3NO |
| Molecular Weight | 155.12 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | (2S,3S)-2-methyl-3-(trifluoromethoxy)azetidine |
| SMILES | C[C@@H]1NC[C@@H]1OC(F)(F)F |
| InChI | InChI=1S/C5H8F3NO/c1-3-4(2-9-3)10-5(6,7)8/h3-4,9H,2H2,1H3/t3-,4-/m0/s1 |
| InChIKey | PIMJEZMQTHGFPD-IMJSIDKUSA-N |
| XLogP | 0.88 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.12 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |