C12H17FN4O — CID 178127103
(2R)-1-(azetidin-1-yl)-2-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]propan-1-one (PubChem CID 178127103) has the molecular formula C12H17FN4O and a molecular weight of 252.29 g/mol. Its IUPAC name is (2R)-1-(azetidin-1-yl)-2-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]propan-1-one.
| Compound Name | (2R)-1-(azetidin-1-yl)-2-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]propan-1-one |
|---|---|
| PubChem CID | 178127103 |
| Molecular Formula | C12H17FN4O |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (2R)-1-(azetidin-1-yl)-2-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]propan-1-one |
| SMILES | CCc1ncnc(N[C@H](C)C(=O)N2CCC2)c1F |
| InChI | InChI=1S/C12H17FN4O/c1-3-9-10(13)11(15-7-14-9)16-8(2)12(18)17-5-4-6-17/h7-8H,3-6H2,1-2H3,(H,14,15,16)/t8-/m1/s1 |
| InChIKey | JVRMOUZLWFUUGG-MRVPVSSYSA-N |
| XLogP | 1.21 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |