C12H13FO5 — CID 178127130
5-(3-fluorobicyclo[1.1.1]pentane-1-carbonyl)-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 178127130) has the molecular formula C12H13FO5 and a molecular weight of 256.23 g/mol. Its IUPAC name is 5-(3-fluorobicyclo[1.1.1]pentane-1-carbonyl)-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-(3-fluorobicyclo[1.1.1]pentane-1-carbonyl)-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 178127130 |
| Molecular Formula | C12H13FO5 |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 5-(3-fluorobicyclo[1.1.1]pentane-1-carbonyl)-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(C(=O)C23CC(F)(C2)C3)C(=O)O1 |
| InChI | InChI=1S/C12H13FO5/c1-10(2)17-8(15)6(9(16)18-10)7(14)11-3-12(13,4-11)5-11/h6H,3-5H2,1-2H3 |
| InChIKey | DOKGBIVNYMDRSL-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|