About (2R)-2-amino-1-[(2R,4R)-2-ethenyl-4-methylpiperidin-1-yl]propan-1-one
(2R)-2-amino-1-[(2R,4R)-2-ethenyl-4-methylpiperidin-1-yl]propan-1-one (PubChem CID 178127255) has the molecular formula C11H20N2O
and a molecular weight of 196.29 g/mol. Its IUPAC name is (2R)-2-amino-1-[(2R,4R)-2-ethenyl-4-methylpiperidin-1-yl]propan-1-one.
Molecular Properties
| Compound Name | (2R)-2-amino-1-[(2R,4R)-2-ethenyl-4-methylpiperidin-1-yl]propan-1-one |
| PubChem CID | 178127255 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | (2R)-2-amino-1-[(2R,4R)-2-ethenyl-4-methylpiperidin-1-yl]propan-1-one |
| SMILES | C=C[C@H]1C[C@H](C)CCN1C(=O)[C@@H](C)N |
| InChI | InChI=1S/C11H20N2O/c1-4-10-7-8(2)5-6-13(10)11(14)9(3)12/h4,8-10H,1,5-7,12H2,2-3H3/t8-,9-,10+/m1/s1 |
| InChIKey | ZLJBLHKTYRTYIZ-BBBLOLIVSA-N |
| XLogP | 1.15 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-amino-1-[(2R,4R)-2-ethenyl-4-methylpiperidin-1-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-1-[(2R,4R)-2-ethenyl-4-methylpiperidin-1-yl]propan-1-one?
The IUPAC name of (2R)-2-amino-1-[(2R,4R)-2-ethenyl-4-methylpiperidin-1-yl]propan-1-one (CID 178127255) is (2R)-2-amino-1-[(2R,4R)-2-ethenyl-4-methylpiperidin-1-yl]propan-1-one.
What is the SMILES notation for (2R)-2-amino-1-[(2R,4R)-2-ethenyl-4-methylpiperidin-1-yl]propan-1-one?
The canonical SMILES for (2R)-2-amino-1-[(2R,4R)-2-ethenyl-4-methylpiperidin-1-yl]propan-1-one is C=C[C@H]1C[C@H](C)CCN1C(=O)[C@@H](C)N.
What is the InChIKey of (2R)-2-amino-1-[(2R,4R)-2-ethenyl-4-methylpiperidin-1-yl]propan-1-one?
The InChIKey is ZLJBLHKTYRTYIZ-BBBLOLIVSA-N. The full InChI is InChI=1S/C11H20N2O/c1-4-10-7-8(2)5-6-13(10)11(14)9(3)12/h4,8-10H,1,5-7,12H2,2-3H3/t8-,9-,10+/m1/s1.
What are the key properties of (2R)-2-amino-1-[(2R,4R)-2-ethenyl-4-methylpiperidin-1-yl]propan-1-one?
(2R)-2-amino-1-[(2R,4R)-2-ethenyl-4-methylpiperidin-1-yl]propan-1-one has a molecular weight of 196.29 g/mol, XLogP of 1.15, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-1-[(2R,4R)-2-ethenyl-4-methylpiperidin-1-yl]propan-1-one is sourced from PubChem (CID 178127255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).