About 2-chloro-6-(4-fluorophenyl)pyrazine;ethane
2-chloro-6-(4-fluorophenyl)pyrazine;ethane (PubChem CID 178127340) has the molecular formula C12H12ClFN2
and a molecular weight of 238.69 g/mol. Its IUPAC name is 2-chloro-6-(4-fluorophenyl)pyrazine;ethane.
Molecular Properties
| Compound Name | 2-chloro-6-(4-fluorophenyl)pyrazine;ethane |
| PubChem CID | 178127340 |
| Molecular Formula | C12H12ClFN2 |
| Molecular Weight | 238.69 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 2-chloro-6-(4-fluorophenyl)pyrazine;ethane |
| SMILES | CC.Fc1ccc(-c2cncc(Cl)n2)cc1 |
| InChI | InChI=1S/C10H6ClFN2.C2H6/c11-10-6-13-5-9(14-10)7-1-3-8(12)4-2-7;1-2/h1-6H;1-2H3 |
| InChIKey | WVGZHNWCABMYDE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.69 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-6-(4-fluorophenyl)pyrazine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-(4-fluorophenyl)pyrazine;ethane?
The IUPAC name of 2-chloro-6-(4-fluorophenyl)pyrazine;ethane (CID 178127340) is 2-chloro-6-(4-fluorophenyl)pyrazine;ethane.
What is the SMILES notation for 2-chloro-6-(4-fluorophenyl)pyrazine;ethane?
The canonical SMILES for 2-chloro-6-(4-fluorophenyl)pyrazine;ethane is CC.Fc1ccc(-c2cncc(Cl)n2)cc1.
What is the InChIKey of 2-chloro-6-(4-fluorophenyl)pyrazine;ethane?
The InChIKey is WVGZHNWCABMYDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6ClFN2.C2H6/c11-10-6-13-5-9(14-10)7-1-3-8(12)4-2-7;1-2/h1-6H;1-2H3.
What are the key properties of 2-chloro-6-(4-fluorophenyl)pyrazine;ethane?
2-chloro-6-(4-fluorophenyl)pyrazine;ethane has a molecular weight of 238.69 g/mol, XLogP of 3.96, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-(4-fluorophenyl)pyrazine;ethane is sourced from PubChem (CID 178127340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).