C11H10ClN3O2 — CID 178127775
(2R)-2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]amino]propanal (PubChem CID 178127775) has the molecular formula C11H10ClN3O2 and a molecular weight of 251.67 g/mol. Its IUPAC name is (2R)-2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]amino]propanal.
| Compound Name | (2R)-2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]amino]propanal |
|---|---|
| PubChem CID | 178127775 |
| Molecular Formula | C11H10ClN3O2 |
| Molecular Weight | 251.67 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | (2R)-2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]amino]propanal |
| SMILES | C[C@H](C=O)Nc1nnc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C11H10ClN3O2/c1-7(6-16)13-11-15-14-10(17-11)8-2-4-9(12)5-3-8/h2-7H,1H3,(H,13,15)/t7-/m1/s1 |
| InChIKey | HIRQBTNGFQWBAD-SSDOTTSWSA-N |
| XLogP | 2.39 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.67 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|