About 5-chloro-3-(2-hydroxy-2-methylpropyl)imidazo[4,5-b]pyridin-6-ol
5-chloro-3-(2-hydroxy-2-methylpropyl)imidazo[4,5-b]pyridin-6-ol (PubChem CID 178129898) has the molecular formula C10H12ClN3O2
and a molecular weight of 241.68 g/mol. Its IUPAC name is 5-chloro-3-(2-hydroxy-2-methylpropyl)imidazo[4,5-b]pyridin-6-ol.
Molecular Properties
| Compound Name | 5-chloro-3-(2-hydroxy-2-methylpropyl)imidazo[4,5-b]pyridin-6-ol |
| PubChem CID | 178129898 |
| Molecular Formula | C10H12ClN3O2 |
| Molecular Weight | 241.68 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 5-chloro-3-(2-hydroxy-2-methylpropyl)imidazo[4,5-b]pyridin-6-ol |
| SMILES | CC(C)(O)Cn1cnc2cc(O)c(Cl)nc21 |
| InChI | InChI=1S/C10H12ClN3O2/c1-10(2,16)4-14-5-12-6-3-7(15)8(11)13-9(6)14/h3,5,15-16H,4H2,1-2H3 |
| InChIKey | CLPGAXVPDGCAHT-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.68 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-3-(2-hydroxy-2-methylpropyl)imidazo[4,5-b]pyridin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-(2-hydroxy-2-methylpropyl)imidazo[4,5-b]pyridin-6-ol?
The IUPAC name of 5-chloro-3-(2-hydroxy-2-methylpropyl)imidazo[4,5-b]pyridin-6-ol (CID 178129898) is 5-chloro-3-(2-hydroxy-2-methylpropyl)imidazo[4,5-b]pyridin-6-ol.
What is the SMILES notation for 5-chloro-3-(2-hydroxy-2-methylpropyl)imidazo[4,5-b]pyridin-6-ol?
The canonical SMILES for 5-chloro-3-(2-hydroxy-2-methylpropyl)imidazo[4,5-b]pyridin-6-ol is CC(C)(O)Cn1cnc2cc(O)c(Cl)nc21.
What is the InChIKey of 5-chloro-3-(2-hydroxy-2-methylpropyl)imidazo[4,5-b]pyridin-6-ol?
The InChIKey is CLPGAXVPDGCAHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClN3O2/c1-10(2,16)4-14-5-12-6-3-7(15)8(11)13-9(6)14/h3,5,15-16H,4H2,1-2H3.
What are the key properties of 5-chloro-3-(2-hydroxy-2-methylpropyl)imidazo[4,5-b]pyridin-6-ol?
5-chloro-3-(2-hydroxy-2-methylpropyl)imidazo[4,5-b]pyridin-6-ol has a molecular weight of 241.68 g/mol, XLogP of 1.56, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-(2-hydroxy-2-methylpropyl)imidazo[4,5-b]pyridin-6-ol is sourced from PubChem (CID 178129898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).