C32H40BFN6O5 — CID 178130551
tert-butyl 2-[4-[1-(5-fluoro-2-pyridinyl)ethoxy]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyridin-6-yl]-3-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate (PubChem CID 178130551) has the molecular formula C32H40BFN6O5 and a molecular weight of 618.52 g/mol. Its IUPAC name is tert-butyl 2-[4-[1-(5-fluoro-2-pyridinyl)ethoxy]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyridin-6-yl]-3-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate.
| Compound Name | tert-butyl 2-[4-[1-(5-fluoro-2-pyridinyl)ethoxy]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyridin-6-yl]-3-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate |
|---|---|
| PubChem CID | 178130551 |
| Molecular Formula | C32H40BFN6O5 |
| Molecular Weight | 618.52 g/mol |
| Exact Mass | 618.31 |
| IUPAC Name | tert-butyl 2-[4-[1-(5-fluoro-2-pyridinyl)ethoxy]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyridin-6-yl]-3-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate |
| SMILES | Cc1c(-c2cc(OC(C)c3ccc(F)cn3)c3c(B4OC(C)(C)C(C)(C)O4)cnn3c2)nn2c1CN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C32H40BFN6O5/c1-19-25-18-38(29(41)43-30(3,4)5)12-13-39(25)37-27(19)21-14-26(42-20(2)24-11-10-22(34)15-35-24)28-23(16-36-40(28)17-21)33-44-31(6,7)32(8,9)45-33/h10-11,14-17,20H,12-13,18H2,1-9H3 |
| InChIKey | KMUPRERJVZQSOE-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 105.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.52 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|