C17H13FN2O3S2 — CID 178130812
5-[2-(5-fluoro-6-methoxy-2-methylquinazolin-4-yl)sulfanylacetyl]thiophene-2-carbaldehyde (PubChem CID 178130812) has the molecular formula C17H13FN2O3S2 and a molecular weight of 376.43 g/mol. Its IUPAC name is 5-[2-(5-fluoro-6-methoxy-2-methylquinazolin-4-yl)sulfanylacetyl]thiophene-2-carbaldehyde.
| Compound Name | 5-[2-(5-fluoro-6-methoxy-2-methylquinazolin-4-yl)sulfanylacetyl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 178130812 |
| Molecular Formula | C17H13FN2O3S2 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 5-[2-(5-fluoro-6-methoxy-2-methylquinazolin-4-yl)sulfanylacetyl]thiophene-2-carbaldehyde |
| SMILES | COc1ccc2nc(C)nc(SCC(=O)c3ccc(C=O)s3)c2c1F |
| InChI | InChI=1S/C17H13FN2O3S2/c1-9-19-11-4-5-13(23-2)16(18)15(11)17(20-9)24-8-12(22)14-6-3-10(7-21)25-14/h3-7H,8H2,1-2H3 |
| InChIKey | CKIMDSFENFRWLD-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|