C27H27FN6O2 — CID 178131705
5-[1-[(5-fluoro-2-methyl-3-oxo-4H-quinoxalin-6-yl)methyl]piperidin-4-yl]-N'-phenylpyridine-2-carbohydrazide (PubChem CID 178131705) has the molecular formula C27H27FN6O2 and a molecular weight of 486.55 g/mol. Its IUPAC name is 5-[1-[(5-fluoro-2-methyl-3-oxo-4H-quinoxalin-6-yl)methyl]piperidin-4-yl]-N'-phenylpyridine-2-carbohydrazide.
| Compound Name | 5-[1-[(5-fluoro-2-methyl-3-oxo-4H-quinoxalin-6-yl)methyl]piperidin-4-yl]-N'-phenylpyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 178131705 |
| Molecular Formula | C27H27FN6O2 |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | 5-[1-[(5-fluoro-2-methyl-3-oxo-4H-quinoxalin-6-yl)methyl]piperidin-4-yl]-N'-phenylpyridine-2-carbohydrazide |
| SMILES | Cc1nc2ccc(CN3CCC(c4ccc(C(=O)NNc5ccccc5)nc4)CC3)c(F)c2[nH]c1=O |
| InChI | InChI=1S/C27H27FN6O2/c1-17-26(35)31-25-22(30-17)9-8-20(24(25)28)16-34-13-11-18(12-14-34)19-7-10-23(29-15-19)27(36)33-32-21-5-3-2-4-6-21/h2-10,15,18,32H,11-14,16H2,1H3,(H,31,35)(H,33,36) |
| InChIKey | VNZMFHKIZGQHIG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|