C23H29N7O2 — CID 178131848
5-[4-[(7-ethyl-6-oxo-5H-1,5-naphthyridin-3-yl)methyl]piperazin-1-yl]-N',N'-dimethylpyridine-2-carbohydrazide (PubChem CID 178131848) has the molecular formula C23H29N7O2 and a molecular weight of 435.53 g/mol. Its IUPAC name is 5-[4-[(7-ethyl-6-oxo-5H-1,5-naphthyridin-3-yl)methyl]piperazin-1-yl]-N',N'-dimethylpyridine-2-carbohydrazide.
| Compound Name | 5-[4-[(7-ethyl-6-oxo-5H-1,5-naphthyridin-3-yl)methyl]piperazin-1-yl]-N',N'-dimethylpyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 178131848 |
| Molecular Formula | C23H29N7O2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 5-[4-[(7-ethyl-6-oxo-5H-1,5-naphthyridin-3-yl)methyl]piperazin-1-yl]-N',N'-dimethylpyridine-2-carbohydrazide |
| SMILES | CCc1cc2ncc(CN3CCN(c4ccc(C(=O)NN(C)C)nc4)CC3)cc2[nH]c1=O |
| InChI | InChI=1S/C23H29N7O2/c1-4-17-12-20-21(26-22(17)31)11-16(13-24-20)15-29-7-9-30(10-8-29)18-5-6-19(25-14-18)23(32)27-28(2)3/h5-6,11-14H,4,7-10,15H2,1-3H3,(H,26,31)(H,27,32) |
| InChIKey | WJWPRUJAMBSGGC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|