C10H8BrFN2O — CID 178132037
7-(bromomethyl)-8-fluoro-3-methyl-1H-1,5-naphthyridin-2-one (PubChem CID 178132037) has the molecular formula C10H8BrFN2O and a molecular weight of 271.09 g/mol. Its IUPAC name is 7-(bromomethyl)-8-fluoro-3-methyl-1H-1,5-naphthyridin-2-one.
| Compound Name | 7-(bromomethyl)-8-fluoro-3-methyl-1H-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 178132037 |
| Molecular Formula | C10H8BrFN2O |
| Molecular Weight | 271.09 g/mol |
| Exact Mass | 269.98 |
| IUPAC Name | 7-(bromomethyl)-8-fluoro-3-methyl-1H-1,5-naphthyridin-2-one |
| SMILES | Cc1cc2ncc(CBr)c(F)c2[nH]c1=O |
| InChI | InChI=1S/C10H8BrFN2O/c1-5-2-7-9(14-10(5)15)8(12)6(3-11)4-13-7/h2,4H,3H2,1H3,(H,14,15) |
| InChIKey | MIVNHRUQMYGMAL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.09 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|