C15H19F2NOS — CID 178133022
2-[(2Z,4E,6E)-6-(difluoromethoxy)-7-methylnona-2,4,6-trien-5-yl]-5-methyl-1,3-thiazole (PubChem CID 178133022) has the molecular formula C15H19F2NOS and a molecular weight of 299.39 g/mol. Its IUPAC name is 2-[(2Z,4E,6E)-6-(difluoromethoxy)-7-methylnona-2,4,6-trien-5-yl]-5-methyl-1,3-thiazole.
| Compound Name | 2-[(2Z,4E,6E)-6-(difluoromethoxy)-7-methylnona-2,4,6-trien-5-yl]-5-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 178133022 |
| Molecular Formula | C15H19F2NOS |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-[(2Z,4E,6E)-6-(difluoromethoxy)-7-methylnona-2,4,6-trien-5-yl]-5-methyl-1,3-thiazole |
| SMILES | C/C=C\C=C(C(/OC(F)F)=C(/C)CC)\c1ncc(C)s1 |
| InChI | InChI=1S/C15H19F2NOS/c1-5-7-8-12(14-18-9-11(4)20-14)13(10(3)6-2)19-15(16)17/h5,7-9,15H,6H2,1-4H3/b7-5-,12-8+,13-10+ |
| InChIKey | IQIHHMRQLGNIHU-YSCXGBBCSA-N |
| XLogP | 5.33 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|