About (5-thieno[3,2-c]pyridin-4-yl-1,2-oxazol-3-yl)methanol
(5-thieno[3,2-c]pyridin-4-yl-1,2-oxazol-3-yl)methanol (PubChem CID 178133817) has the molecular formula C11H8N2O2S
and a molecular weight of 232.26 g/mol. Its IUPAC name is (5-thieno[3,2-c]pyridin-4-yl-1,2-oxazol-3-yl)methanol.
Molecular Properties
| Compound Name | (5-thieno[3,2-c]pyridin-4-yl-1,2-oxazol-3-yl)methanol |
| PubChem CID | 178133817 |
| Molecular Formula | C11H8N2O2S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | (5-thieno[3,2-c]pyridin-4-yl-1,2-oxazol-3-yl)methanol |
| SMILES | OCc1cc(-c2nccc3sccc23)on1 |
| InChI | InChI=1S/C11H8N2O2S/c14-6-7-5-9(15-13-7)11-8-2-4-16-10(8)1-3-12-11/h1-5,14H,6H2 |
| InChIKey | WXHGBVZMRQISCE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-thieno[3,2-c]pyridin-4-yl-1,2-oxazol-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-thieno[3,2-c]pyridin-4-yl-1,2-oxazol-3-yl)methanol?
The IUPAC name of (5-thieno[3,2-c]pyridin-4-yl-1,2-oxazol-3-yl)methanol (CID 178133817) is (5-thieno[3,2-c]pyridin-4-yl-1,2-oxazol-3-yl)methanol.
What is the SMILES notation for (5-thieno[3,2-c]pyridin-4-yl-1,2-oxazol-3-yl)methanol?
The canonical SMILES for (5-thieno[3,2-c]pyridin-4-yl-1,2-oxazol-3-yl)methanol is OCc1cc(-c2nccc3sccc23)on1.
What is the InChIKey of (5-thieno[3,2-c]pyridin-4-yl-1,2-oxazol-3-yl)methanol?
The InChIKey is WXHGBVZMRQISCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O2S/c14-6-7-5-9(15-13-7)11-8-2-4-16-10(8)1-3-12-11/h1-5,14H,6H2.
What are the key properties of (5-thieno[3,2-c]pyridin-4-yl-1,2-oxazol-3-yl)methanol?
(5-thieno[3,2-c]pyridin-4-yl-1,2-oxazol-3-yl)methanol has a molecular weight of 232.26 g/mol, XLogP of 2.44, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-thieno[3,2-c]pyridin-4-yl-1,2-oxazol-3-yl)methanol is sourced from PubChem (CID 178133817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).