C13H8F2N2O2S — CID 178133976
5-[5-(difluoromethoxy)pyrazolo[1,5-a]pyridin-6-yl]thiophene-2-carbaldehyde (PubChem CID 178133976) has the molecular formula C13H8F2N2O2S and a molecular weight of 294.28 g/mol. Its IUPAC name is 5-[5-(difluoromethoxy)pyrazolo[1,5-a]pyridin-6-yl]thiophene-2-carbaldehyde.
| Compound Name | 5-[5-(difluoromethoxy)pyrazolo[1,5-a]pyridin-6-yl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 178133976 |
| Molecular Formula | C13H8F2N2O2S |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 5-[5-(difluoromethoxy)pyrazolo[1,5-a]pyridin-6-yl]thiophene-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2cn3nccc3cc2OC(F)F)s1 |
| InChI | InChI=1S/C13H8F2N2O2S/c14-13(15)19-11-5-8-3-4-16-17(8)6-10(11)12-2-1-9(7-18)20-12/h1-7,13H |
| InChIKey | MQJDODUGHPYTAK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|