About (3E)-3-(difluoromethoxy)penta-1,3-dien-2-amine;ethane
(3E)-3-(difluoromethoxy)penta-1,3-dien-2-amine;ethane (PubChem CID 178134131) has the molecular formula C8H15F2NO
and a molecular weight of 179.21 g/mol. Its IUPAC name is (3E)-3-(difluoromethoxy)penta-1,3-dien-2-amine;ethane.
Molecular Properties
| Compound Name | (3E)-3-(difluoromethoxy)penta-1,3-dien-2-amine;ethane |
| PubChem CID | 178134131 |
| Molecular Formula | C8H15F2NO |
| Molecular Weight | 179.21 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | (3E)-3-(difluoromethoxy)penta-1,3-dien-2-amine;ethane |
| SMILES | C=C(N)/C(=C\C)OC(F)F.CC |
| InChI | InChI=1S/C6H9F2NO.C2H6/c1-3-5(4(2)9)10-6(7)8;1-2/h3,6H,2,9H2,1H3;1-2H3/b5-3+; |
| InChIKey | GZZZKJAMODEOOE-WGCWOXMQSA-N |
| XLogP | 2.63 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.21 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-(difluoromethoxy)penta-1,3-dien-2-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-(difluoromethoxy)penta-1,3-dien-2-amine;ethane?
The IUPAC name of (3E)-3-(difluoromethoxy)penta-1,3-dien-2-amine;ethane (CID 178134131) is (3E)-3-(difluoromethoxy)penta-1,3-dien-2-amine;ethane.
What is the SMILES notation for (3E)-3-(difluoromethoxy)penta-1,3-dien-2-amine;ethane?
The canonical SMILES for (3E)-3-(difluoromethoxy)penta-1,3-dien-2-amine;ethane is C=C(N)/C(=C\C)OC(F)F.CC.
What is the InChIKey of (3E)-3-(difluoromethoxy)penta-1,3-dien-2-amine;ethane?
The InChIKey is GZZZKJAMODEOOE-WGCWOXMQSA-N. The full InChI is InChI=1S/C6H9F2NO.C2H6/c1-3-5(4(2)9)10-6(7)8;1-2/h3,6H,2,9H2,1H3;1-2H3/b5-3+;.
What are the key properties of (3E)-3-(difluoromethoxy)penta-1,3-dien-2-amine;ethane?
(3E)-3-(difluoromethoxy)penta-1,3-dien-2-amine;ethane has a molecular weight of 179.21 g/mol, XLogP of 2.63, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-(difluoromethoxy)penta-1,3-dien-2-amine;ethane is sourced from PubChem (CID 178134131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).