About 6-benzyl-3-aza-6-azoniatricyclo[4.2.0.01,3]octane
6-benzyl-3-aza-6-azoniatricyclo[4.2.0.01,3]octane (PubChem CID 178134621) has the molecular formula C13H17N2+
and a molecular weight of 201.29 g/mol. Its IUPAC name is 6-benzyl-3-aza-6-azoniatricyclo[4.2.0.01,3]octane.
Molecular Properties
| Compound Name | 6-benzyl-3-aza-6-azoniatricyclo[4.2.0.01,3]octane |
| PubChem CID | 178134621 |
| Molecular Formula | C13H17N2+ |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | 6-benzyl-3-aza-6-azoniatricyclo[4.2.0.01,3]octane |
| SMILES | c1ccc(C[N+]23CCN4CC42CC3)cc1 |
| InChI | InChI=1S/C13H17N2/c1-2-4-12(5-3-1)10-15-8-6-13(15)11-14(13)7-9-15/h1-5H,6-11H2/q+1 |
| InChIKey | DRADXGOUWORVMZ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 6-benzyl-3-aza-6-azoniatricyclo[4.2.0.01,3]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-benzyl-3-aza-6-azoniatricyclo[4.2.0.01,3]octane?
The IUPAC name of 6-benzyl-3-aza-6-azoniatricyclo[4.2.0.01,3]octane (CID 178134621) is 6-benzyl-3-aza-6-azoniatricyclo[4.2.0.01,3]octane.
What is the SMILES notation for 6-benzyl-3-aza-6-azoniatricyclo[4.2.0.01,3]octane?
The canonical SMILES for 6-benzyl-3-aza-6-azoniatricyclo[4.2.0.01,3]octane is c1ccc(C[N+]23CCN4CC42CC3)cc1.
What is the InChIKey of 6-benzyl-3-aza-6-azoniatricyclo[4.2.0.01,3]octane?
The InChIKey is DRADXGOUWORVMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N2/c1-2-4-12(5-3-1)10-15-8-6-13(15)11-14(13)7-9-15/h1-5H,6-11H2/q+1.
What are the key properties of 6-benzyl-3-aza-6-azoniatricyclo[4.2.0.01,3]octane?
6-benzyl-3-aza-6-azoniatricyclo[4.2.0.01,3]octane has a molecular weight of 201.29 g/mol, XLogP of 1.43, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-benzyl-3-aza-6-azoniatricyclo[4.2.0.01,3]octane is sourced from PubChem (CID 178134621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).