C17H22F3N5O2 — CID 178134720
1-[(Z)-1-amino-3-[[2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-4-pyridinyl]amino]prop-2-enylidene]-3-[(1S)-1-cyclopropylethyl]urea (PubChem CID 178134720) has the molecular formula C17H22F3N5O2 and a molecular weight of 385.39 g/mol. Its IUPAC name is 1-[(Z)-1-amino-3-[[2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-4-pyridinyl]amino]prop-2-enylidene]-3-[(1S)-1-cyclopropylethyl]urea.
| Compound Name | 1-[(Z)-1-amino-3-[[2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-4-pyridinyl]amino]prop-2-enylidene]-3-[(1S)-1-cyclopropylethyl]urea |
|---|---|
| PubChem CID | 178134720 |
| Molecular Formula | C17H22F3N5O2 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 1-[(Z)-1-amino-3-[[2-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-4-pyridinyl]amino]prop-2-enylidene]-3-[(1S)-1-cyclopropylethyl]urea |
| SMILES | C[C@H](NC(=O)N=C(N)/C=C\Nc1ccnc(C(C)(O)C(F)(F)F)c1)C1CC1 |
| InChI | InChI=1S/C17H22F3N5O2/c1-10(11-3-4-11)24-15(26)25-14(21)6-8-22-12-5-7-23-13(9-12)16(2,27)17(18,19)20/h5-11,27H,3-4H2,1-2H3,(H,22,23)(H3,21,24,25,26)/b8-6-/t10-,16?/m0/s1 |
| InChIKey | GXYCIKKIJAAZOC-QBPWWWJMSA-N |
| XLogP | 2.64 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|