C18H17FN3O- — CID 178135367
3-fluoro-4-[(6-piperidin-1-id-4-yl-2-pyridinyl)oxymethyl]benzonitrile (PubChem CID 178135367) has the molecular formula C18H17FN3O- and a molecular weight of 310.35 g/mol. Its IUPAC name is 3-fluoro-4-[(6-piperidin-1-id-4-yl-2-pyridinyl)oxymethyl]benzonitrile.
| Compound Name | 3-fluoro-4-[(6-piperidin-1-id-4-yl-2-pyridinyl)oxymethyl]benzonitrile |
|---|---|
| PubChem CID | 178135367 |
| Molecular Formula | C18H17FN3O- |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 3-fluoro-4-[(6-piperidin-1-id-4-yl-2-pyridinyl)oxymethyl]benzonitrile |
| SMILES | N#Cc1ccc(COc2cccc(C3CC[N-]CC3)n2)c(F)c1 |
| InChI | InChI=1S/C18H17FN3O/c19-16-10-13(11-20)4-5-15(16)12-23-18-3-1-2-17(22-18)14-6-8-21-9-7-14/h1-5,10,14H,6-9,12H2/q-1 |
| InChIKey | OCTZOJACUDXKON-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 60.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |