C19H25F3N2O — CID 178135409
2-piperidin-4-yl-6-[[4-(trifluoromethyl)-1-bicyclo[2.2.1]heptanyl]methoxy]pyridine (PubChem CID 178135409) has the molecular formula C19H25F3N2O and a molecular weight of 354.42 g/mol. Its IUPAC name is 2-piperidin-4-yl-6-[[4-(trifluoromethyl)-1-bicyclo[2.2.1]heptanyl]methoxy]pyridine.
| Compound Name | 2-piperidin-4-yl-6-[[4-(trifluoromethyl)-1-bicyclo[2.2.1]heptanyl]methoxy]pyridine |
|---|---|
| PubChem CID | 178135409 |
| Molecular Formula | C19H25F3N2O |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 2-piperidin-4-yl-6-[[4-(trifluoromethyl)-1-bicyclo[2.2.1]heptanyl]methoxy]pyridine |
| SMILES | FC(F)(F)C12CCC(COc3cccc(C4CCNCC4)n3)(CC1)C2 |
| InChI | InChI=1S/C19H25F3N2O/c20-19(21,22)18-8-6-17(12-18,7-9-18)13-25-16-3-1-2-15(24-16)14-4-10-23-11-5-14/h1-3,14,23H,4-13H2 |
| InChIKey | AGVUKUORHZQAQP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |