C20H24N2OS — CID 178136016
9-(benzylsulfanylmethyl)-3,11-diazatricyclo[6.5.1.04,14]tetradeca-1,4,6,8(14)-tetraen-10-one;molecular hydrogen (PubChem CID 178136016) has the molecular formula C20H24N2OS and a molecular weight of 340.49 g/mol. Its IUPAC name is 9-(benzylsulfanylmethyl)-3,11-diazatricyclo[6.5.1.04,14]tetradeca-1,4,6,8(14)-tetraen-10-one;molecular hydrogen.
| Compound Name | 9-(benzylsulfanylmethyl)-3,11-diazatricyclo[6.5.1.04,14]tetradeca-1,4,6,8(14)-tetraen-10-one;molecular hydrogen |
|---|---|
| PubChem CID | 178136016 |
| Molecular Formula | C20H24N2OS |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 9-(benzylsulfanylmethyl)-3,11-diazatricyclo[6.5.1.04,14]tetradeca-1,4,6,8(14)-tetraen-10-one;molecular hydrogen |
| SMILES | O=C1NCCc2c[nH]c3cccc(c23)C1CSCc1ccccc1.[H][H].[H][H] |
| InChI | InChI=1S/C20H20N2OS.2H2/c23-20-17(13-24-12-14-5-2-1-3-6-14)16-7-4-8-18-19(16)15(11-22-18)9-10-21-20;;/h1-8,11,17,22H,9-10,12-13H2,(H,21,23);2*1H |
| InChIKey | QIJCDNRUGZGKKK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |