C23H20BrF2N3O3S — CID 178136227
5-(3-bromo-4-fluorophenyl)-3-[2-(3-fluoro-3-methylazetidin-1-yl)-2-oxoethyl]-6-(5-hydroxypent-1-ynyl)thieno[2,3-d]pyrimidin-4-one (PubChem CID 178136227) has the molecular formula C23H20BrF2N3O3S and a molecular weight of 536.40 g/mol. Its IUPAC name is 5-(3-bromo-4-fluorophenyl)-3-[2-(3-fluoro-3-methylazetidin-1-yl)-2-oxoethyl]-6-(5-hydroxypent-1-ynyl)thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(3-bromo-4-fluorophenyl)-3-[2-(3-fluoro-3-methylazetidin-1-yl)-2-oxoethyl]-6-(5-hydroxypent-1-ynyl)thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 178136227 |
| Molecular Formula | C23H20BrF2N3O3S |
| Molecular Weight | 536.40 g/mol |
| Exact Mass | 535.04 |
| IUPAC Name | 5-(3-bromo-4-fluorophenyl)-3-[2-(3-fluoro-3-methylazetidin-1-yl)-2-oxoethyl]-6-(5-hydroxypent-1-ynyl)thieno[2,3-d]pyrimidin-4-one |
| SMILES | CC1(F)CN(C(=O)Cn2cnc3sc(C#CCCCO)c(-c4ccc(F)c(Br)c4)c3c2=O)C1 |
| InChI | InChI=1S/C23H20BrF2N3O3S/c1-23(26)11-29(12-23)18(31)10-28-13-27-21-20(22(28)32)19(14-6-7-16(25)15(24)9-14)17(33-21)5-3-2-4-8-30/h6-7,9,13,30H,2,4,8,10-12H2,1H3 |
| InChIKey | ZYFKTZWDFKGPQL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|